C9H7IN4 — CID 134267009
2-iodo-4-(pyridin-2-ylmethyl)-1,3,5-triazine (PubChem CID 134267009) has the molecular formula C9H7IN4 and a molecular weight of 298.09 g/mol. Its IUPAC name is 2-iodo-4-(pyridin-2-ylmethyl)-1,3,5-triazine.
| Compound Name | 2-iodo-4-(pyridin-2-ylmethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 134267009 |
| Molecular Formula | C9H7IN4 |
| Molecular Weight | 298.09 g/mol |
| Exact Mass | 297.97 |
| IUPAC Name | 2-iodo-4-(pyridin-2-ylmethyl)-1,3,5-triazine |
| SMILES | Ic1ncnc(Cc2ccccn2)n1 |
| InChI | InChI=1S/C9H7IN4/c10-9-13-6-12-8(14-9)5-7-3-1-2-4-11-7/h1-4,6H,5H2 |
| InChIKey | ADIOTLFZMXBYOW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.09 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|