C8H6IN3S — CID 102618578
5-iodo-3-(pyridin-2-ylmethyl)-1,2,4-thiadiazole (PubChem CID 102618578) has the molecular formula C8H6IN3S and a molecular weight of 303.13 g/mol. Its IUPAC name is 5-iodo-3-(pyridin-2-ylmethyl)-1,2,4-thiadiazole.
| Compound Name | 5-iodo-3-(pyridin-2-ylmethyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102618578 |
| Molecular Formula | C8H6IN3S |
| Molecular Weight | 303.13 g/mol |
| Exact Mass | 302.93 |
| IUPAC Name | 5-iodo-3-(pyridin-2-ylmethyl)-1,2,4-thiadiazole |
| SMILES | Ic1nc(Cc2ccccn2)ns1 |
| InChI | InChI=1S/C8H6IN3S/c9-8-11-7(12-13-8)5-6-3-1-2-4-10-6/h1-4H,5H2 |
| InChIKey | SOHHNEJQBBISIG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.13 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|