C19H16N6S — CID 91108299
3-[7-methyl-4-(pyridin-3-ylmethyldiazenyl)thieno[3,2-d]pyrimidin-6-yl]aniline (PubChem CID 91108299) has the molecular formula C19H16N6S and a molecular weight of 360.45 g/mol. Its IUPAC name is 3-[7-methyl-4-(pyridin-3-ylmethyldiazenyl)thieno[3,2-d]pyrimidin-6-yl]aniline.
| Compound Name | 3-[7-methyl-4-(pyridin-3-ylmethyldiazenyl)thieno[3,2-d]pyrimidin-6-yl]aniline |
|---|---|
| PubChem CID | 91108299 |
| Molecular Formula | C19H16N6S |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 3-[7-methyl-4-(pyridin-3-ylmethyldiazenyl)thieno[3,2-d]pyrimidin-6-yl]aniline |
| SMILES | Cc1c(-c2cccc(N)c2)sc2c(/N=N/Cc3cccnc3)ncnc12 |
| InChI | InChI=1S/C19H16N6S/c1-12-16-18(26-17(12)14-5-2-6-15(20)8-14)19(23-11-22-16)25-24-10-13-4-3-7-21-9-13/h2-9,11H,10,20H2,1H3/b25-24+ |
| InChIKey | OLSGCUICDTYLAF-OCOZRVBESA-N |
| XLogP | 4.93 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|