C10H10N2S — CID 165438455
3-(4-methyl-1,3-thiazol-5-yl)aniline (PubChem CID 165438455) has the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. Its IUPAC name is 3-(4-methyl-1,3-thiazol-5-yl)aniline.
| Compound Name | 3-(4-methyl-1,3-thiazol-5-yl)aniline |
|---|---|
| PubChem CID | 165438455 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 3-(4-methyl-1,3-thiazol-5-yl)aniline |
| SMILES | Cc1ncsc1-c1cccc(N)c1 |
| InChI | InChI=1S/C10H10N2S/c1-7-10(13-6-12-7)8-3-2-4-9(11)5-8/h2-6H,11H2,1H3 |
| InChIKey | ANNUICXNMRUWDE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|