C14H10N8S — CID 91333738
pyridin-3-ylmethyl-[1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]diazene (PubChem CID 91333738) has the molecular formula C14H10N8S and a molecular weight of 322.36 g/mol. Its IUPAC name is pyridin-3-ylmethyl-[1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]diazene.
| Compound Name | pyridin-3-ylmethyl-[1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]diazene |
|---|---|
| PubChem CID | 91333738 |
| Molecular Formula | C14H10N8S |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | pyridin-3-ylmethyl-[1-(1,3-thiazol-2-yl)pyrazolo[3,4-d]pyrimidin-4-yl]diazene |
| SMILES | c1cncc(C/N=N/c2ncnc3c2cnn3-c2nccs2)c1 |
| InChI | InChI=1S/C14H10N8S/c1-2-10(6-15-3-1)7-19-21-12-11-8-20-22(13(11)18-9-17-12)14-16-4-5-23-14/h1-6,8-9H,7H2/b21-19+ |
| InChIKey | MFMWIFYTUVUSGQ-XUTLUUPISA-N |
| XLogP | 2.95 |
| TPSA | 94.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|