C22H20N8O2 — CID 90967064
N-(3-oxobutyl)-4-[[(1-pyridin-2-ylpyrazolo[3,4-d]pyrimidin-4-yl)diazenyl]methyl]benzamide (PubChem CID 90967064) has the molecular formula C22H20N8O2 and a molecular weight of 428.46 g/mol. Its IUPAC name is N-(3-oxobutyl)-4-[[(1-pyridin-2-ylpyrazolo[3,4-d]pyrimidin-4-yl)diazenyl]methyl]benzamide.
| Compound Name | N-(3-oxobutyl)-4-[[(1-pyridin-2-ylpyrazolo[3,4-d]pyrimidin-4-yl)diazenyl]methyl]benzamide |
|---|---|
| PubChem CID | 90967064 |
| Molecular Formula | C22H20N8O2 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-(3-oxobutyl)-4-[[(1-pyridin-2-ylpyrazolo[3,4-d]pyrimidin-4-yl)diazenyl]methyl]benzamide |
| SMILES | CC(=O)CCNC(=O)c1ccc(C/N=N/c2ncnc3c2cnn3-c2ccccn2)cc1 |
| InChI | InChI=1S/C22H20N8O2/c1-15(31)9-11-24-22(32)17-7-5-16(6-8-17)12-27-29-20-18-13-28-30(21(18)26-14-25-20)19-4-2-3-10-23-19/h2-8,10,13-14H,9,11-12H2,1H3,(H,24,32)/b29-27+ |
| InChIKey | SSPFIBHWSPWSBI-ORIPQNMZSA-N |
| XLogP | 3.20 |
| TPSA | 127.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|