C20H16N6O2 — CID 91340645
4-[[[1-(3-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]benzoic acid (PubChem CID 91340645) has the molecular formula C20H16N6O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is 4-[[[1-(3-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]benzoic acid.
| Compound Name | 4-[[[1-(3-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 91340645 |
| Molecular Formula | C20H16N6O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 4-[[[1-(3-methylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]benzoic acid |
| SMILES | Cc1cccc(-n2ncc3c(/N=N/Cc4ccc(C(=O)O)cc4)ncnc32)c1 |
| InChI | InChI=1S/C20H16N6O2/c1-13-3-2-4-16(9-13)26-19-17(11-24-26)18(21-12-22-19)25-23-10-14-5-7-15(8-6-14)20(27)28/h2-9,11-12H,10H2,1H3,(H,27,28)/b25-23+ |
| InChIKey | XCWVICKRRYCUIH-WJTDDFOZSA-N |
| XLogP | 4.11 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|