C19H17N7O — CID 91412413
3-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]aniline (PubChem CID 91412413) has the molecular formula C19H17N7O and a molecular weight of 359.39 g/mol. Its IUPAC name is 3-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]aniline.
| Compound Name | 3-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]aniline |
|---|---|
| PubChem CID | 91412413 |
| Molecular Formula | C19H17N7O |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 3-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]aniline |
| SMILES | COc1cccc(-n2ncc3c(/N=N/Cc4cccc(N)c4)ncnc32)c1 |
| InChI | InChI=1S/C19H17N7O/c1-27-16-7-3-6-15(9-16)26-19-17(11-24-26)18(21-12-22-19)25-23-10-13-4-2-5-14(20)8-13/h2-9,11-12H,10,20H2,1H3/b25-23+ |
| InChIKey | SAYRDVNPGVTKEX-WJTDDFOZSA-N |
| XLogP | 3.69 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|