C20H17FN6O2 — CID 91135738
(3-fluoro-4-methoxyphenyl)methyl-[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazene (PubChem CID 91135738) has the molecular formula C20H17FN6O2 and a molecular weight of 392.39 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl-[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazene.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl-[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazene |
|---|---|
| PubChem CID | 91135738 |
| Molecular Formula | C20H17FN6O2 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl-[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazene |
| SMILES | COc1cccc(-n2ncc3c(/N=N/Cc4ccc(OC)c(F)c4)ncnc32)c1 |
| InChI | InChI=1S/C20H17FN6O2/c1-28-15-5-3-4-14(9-15)27-20-16(11-25-27)19(22-12-23-20)26-24-10-13-6-7-18(29-2)17(21)8-13/h3-9,11-12H,10H2,1-2H3/b26-24+ |
| InChIKey | GGUIPIXAJFRLEI-SHHOIMCASA-N |
| XLogP | 4.26 |
| TPSA | 86.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|