C23H19N5O2S — CID 91112261
6-(2-ethoxyphenyl)-4-[(3-methoxyphenyl)methyldiazenyl]thieno[3,2-d]pyrimidine-7-carbonitrile (PubChem CID 91112261) has the molecular formula C23H19N5O2S and a molecular weight of 429.51 g/mol. Its IUPAC name is 6-(2-ethoxyphenyl)-4-[(3-methoxyphenyl)methyldiazenyl]thieno[3,2-d]pyrimidine-7-carbonitrile.
| Compound Name | 6-(2-ethoxyphenyl)-4-[(3-methoxyphenyl)methyldiazenyl]thieno[3,2-d]pyrimidine-7-carbonitrile |
|---|---|
| PubChem CID | 91112261 |
| Molecular Formula | C23H19N5O2S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 6-(2-ethoxyphenyl)-4-[(3-methoxyphenyl)methyldiazenyl]thieno[3,2-d]pyrimidine-7-carbonitrile |
| SMILES | CCOc1ccccc1-c1sc2c(/N=N/Cc3cccc(OC)c3)ncnc2c1C#N |
| InChI | InChI=1S/C23H19N5O2S/c1-3-30-19-10-5-4-9-17(19)21-18(12-24)20-22(31-21)23(26-14-25-20)28-27-13-15-7-6-8-16(11-15)29-2/h4-11,14H,3,13H2,1-2H3/b28-27+ |
| InChIKey | GPJYIBNWNLYAGA-BYYHNAKLSA-N |
| XLogP | 5.92 |
| TPSA | 92.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|