C22H17N5O2S — CID 91144431
2-[4-[(3-hydroxy-4-methoxyphenyl)methyldiazenyl]-7-methylthieno[3,2-d]pyrimidin-6-yl]benzonitrile (PubChem CID 91144431) has the molecular formula C22H17N5O2S and a molecular weight of 415.48 g/mol. Its IUPAC name is 2-[4-[(3-hydroxy-4-methoxyphenyl)methyldiazenyl]-7-methylthieno[3,2-d]pyrimidin-6-yl]benzonitrile.
| Compound Name | 2-[4-[(3-hydroxy-4-methoxyphenyl)methyldiazenyl]-7-methylthieno[3,2-d]pyrimidin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 91144431 |
| Molecular Formula | C22H17N5O2S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-[4-[(3-hydroxy-4-methoxyphenyl)methyldiazenyl]-7-methylthieno[3,2-d]pyrimidin-6-yl]benzonitrile |
| SMILES | COc1ccc(C/N=N/c2ncnc3c(C)c(-c4ccccc4C#N)sc23)cc1O |
| InChI | InChI=1S/C22H17N5O2S/c1-13-19-21(30-20(13)16-6-4-3-5-15(16)10-23)22(25-12-24-19)27-26-11-14-7-8-18(29-2)17(28)9-14/h3-9,12,28H,11H2,1-2H3/b27-26+ |
| InChIKey | WNDWAICJDDYVOM-CYYJNZCTSA-N |
| XLogP | 5.54 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|