C22H19FN4O4S — CID 91452811
6-(2-ethoxy-4-fluorophenyl)-4-[(3-hydroxy-4-methoxyphenyl)methyldiazenyl]thieno[3,2-d]pyrimidin-7-ol (PubChem CID 91452811) has the molecular formula C22H19FN4O4S and a molecular weight of 454.48 g/mol. Its IUPAC name is 6-(2-ethoxy-4-fluorophenyl)-4-[(3-hydroxy-4-methoxyphenyl)methyldiazenyl]thieno[3,2-d]pyrimidin-7-ol.
| Compound Name | 6-(2-ethoxy-4-fluorophenyl)-4-[(3-hydroxy-4-methoxyphenyl)methyldiazenyl]thieno[3,2-d]pyrimidin-7-ol |
|---|---|
| PubChem CID | 91452811 |
| Molecular Formula | C22H19FN4O4S |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 6-(2-ethoxy-4-fluorophenyl)-4-[(3-hydroxy-4-methoxyphenyl)methyldiazenyl]thieno[3,2-d]pyrimidin-7-ol |
| SMILES | CCOc1cc(F)ccc1-c1sc2c(/N=N/Cc3ccc(OC)c(O)c3)ncnc2c1O |
| InChI | InChI=1S/C22H19FN4O4S/c1-3-31-17-9-13(23)5-6-14(17)20-19(29)18-21(32-20)22(25-11-24-18)27-26-10-12-4-7-16(30-2)15(28)8-12/h4-9,11,28-29H,3,10H2,1-2H3/b27-26+ |
| InChIKey | YTVUYWCZIHLWQS-CYYJNZCTSA-N |
| XLogP | 5.60 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|