C20H18N4O3S — CID 91065845
6-(2-ethoxyphenyl)-4-[(5-methylfuran-2-yl)methyldiazenyl]thieno[3,2-d]pyrimidin-7-ol (PubChem CID 91065845) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is 6-(2-ethoxyphenyl)-4-[(5-methylfuran-2-yl)methyldiazenyl]thieno[3,2-d]pyrimidin-7-ol.
| Compound Name | 6-(2-ethoxyphenyl)-4-[(5-methylfuran-2-yl)methyldiazenyl]thieno[3,2-d]pyrimidin-7-ol |
|---|---|
| PubChem CID | 91065845 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 6-(2-ethoxyphenyl)-4-[(5-methylfuran-2-yl)methyldiazenyl]thieno[3,2-d]pyrimidin-7-ol |
| SMILES | CCOc1ccccc1-c1sc2c(/N=N/Cc3ccc(C)o3)ncnc2c1O |
| InChI | InChI=1S/C20H18N4O3S/c1-3-26-15-7-5-4-6-14(15)18-17(25)16-19(28-18)20(22-11-21-16)24-23-10-13-9-8-12(2)27-13/h4-9,11,25H,3,10H2,1-2H3/b24-23+ |
| InChIKey | VQYQVQJHLGCJES-WCWDXBQESA-N |
| XLogP | 5.65 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|