C23H19N5O3S — CID 91503262
6-(2-ethoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyldiazenyl]thieno[3,2-d]pyrimidine-7-carbonitrile (PubChem CID 91503262) has the molecular formula C23H19N5O3S and a molecular weight of 445.50 g/mol. Its IUPAC name is 6-(2-ethoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyldiazenyl]thieno[3,2-d]pyrimidine-7-carbonitrile.
| Compound Name | 6-(2-ethoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyldiazenyl]thieno[3,2-d]pyrimidine-7-carbonitrile |
|---|---|
| PubChem CID | 91503262 |
| Molecular Formula | C23H19N5O3S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 6-(2-ethoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyldiazenyl]thieno[3,2-d]pyrimidine-7-carbonitrile |
| SMILES | CCOc1ccccc1-c1sc2c(/N=N/Cc3ccc(O)c(OC)c3)ncnc2c1C#N |
| InChI | InChI=1S/C23H19N5O3S/c1-3-31-18-7-5-4-6-15(18)21-16(11-24)20-22(32-21)23(26-13-25-20)28-27-12-14-8-9-17(29)19(10-14)30-2/h4-10,13,29H,3,12H2,1-2H3/b28-27+ |
| InChIKey | USWQKBBUJMLONY-BYYHNAKLSA-N |
| XLogP | 5.63 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|