C24H19N5O3S — CID 73038919
methyl N-[7-cyano-6-(2-ethoxyphenyl)thieno[3,2-d]pyrimidin-4-yl]-4-formylbenzenecarbohydrazonate (PubChem CID 73038919) has the molecular formula C24H19N5O3S and a molecular weight of 457.52 g/mol. Its IUPAC name is methyl N-[7-cyano-6-(2-ethoxyphenyl)thieno[3,2-d]pyrimidin-4-yl]-4-formylbenzenecarbohydrazonate.
| Compound Name | methyl N-[7-cyano-6-(2-ethoxyphenyl)thieno[3,2-d]pyrimidin-4-yl]-4-formylbenzenecarbohydrazonate |
|---|---|
| PubChem CID | 73038919 |
| Molecular Formula | C24H19N5O3S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | methyl N-[7-cyano-6-(2-ethoxyphenyl)thieno[3,2-d]pyrimidin-4-yl]-4-formylbenzenecarbohydrazonate |
| SMILES | CCOc1ccccc1-c1sc2c(NN=C(OC)c3ccc(C=O)cc3)ncnc2c1C#N |
| InChI | InChI=1S/C24H19N5O3S/c1-3-32-19-7-5-4-6-17(19)21-18(12-25)20-22(33-21)23(27-14-26-20)28-29-24(31-2)16-10-8-15(13-30)9-11-16/h4-11,13-14H,3H2,1-2H3,(H,26,27,28) |
| InChIKey | SAODNFGBFBTCEC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|