C20H18N4O2S2 — CID 11567741
6-(2-ethoxyphenyl)-4-[(2E)-2-[(5-methylthiophen-2-yl)methylidene]hydrazinyl]thieno[3,2-d]pyrimidin-7-ol (PubChem CID 11567741) has the molecular formula C20H18N4O2S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 6-(2-ethoxyphenyl)-4-[(2E)-2-[(5-methylthiophen-2-yl)methylidene]hydrazinyl]thieno[3,2-d]pyrimidin-7-ol.
| Compound Name | 6-(2-ethoxyphenyl)-4-[(2E)-2-[(5-methylthiophen-2-yl)methylidene]hydrazinyl]thieno[3,2-d]pyrimidin-7-ol |
|---|---|
| PubChem CID | 11567741 |
| Molecular Formula | C20H18N4O2S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 6-(2-ethoxyphenyl)-4-[(2E)-2-[(5-methylthiophen-2-yl)methylidene]hydrazinyl]thieno[3,2-d]pyrimidin-7-ol |
| SMILES | CCOc1ccccc1-c1sc2c(N/N=C/c3ccc(C)s3)ncnc2c1O |
| InChI | InChI=1S/C20H18N4O2S2/c1-3-26-15-7-5-4-6-14(15)18-17(25)16-19(28-18)20(22-11-21-16)24-23-10-13-9-8-12(2)27-13/h4-11,25H,3H2,1-2H3,(H,21,22,24)/b23-10+ |
| InChIKey | YFXKBNCHDWXIGI-AUEPDCJTSA-N |
| XLogP | 5.28 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|