C20H17FN4O2S2 — CID 11532024
[6-(2-ethoxy-4-fluorophenyl)-4-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]thieno[3,2-d]pyrimidin-7-yl]methanol (PubChem CID 11532024) has the molecular formula C20H17FN4O2S2 and a molecular weight of 428.51 g/mol. Its IUPAC name is [6-(2-ethoxy-4-fluorophenyl)-4-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]thieno[3,2-d]pyrimidin-7-yl]methanol.
| Compound Name | [6-(2-ethoxy-4-fluorophenyl)-4-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]thieno[3,2-d]pyrimidin-7-yl]methanol |
|---|---|
| PubChem CID | 11532024 |
| Molecular Formula | C20H17FN4O2S2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | [6-(2-ethoxy-4-fluorophenyl)-4-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]thieno[3,2-d]pyrimidin-7-yl]methanol |
| SMILES | CCOc1cc(F)ccc1-c1sc2c(N/N=C/c3cccs3)ncnc2c1CO |
| InChI | InChI=1S/C20H17FN4O2S2/c1-2-27-16-8-12(21)5-6-14(16)18-15(10-26)17-19(29-18)20(23-11-22-17)25-24-9-13-4-3-7-28-13/h3-9,11,26H,2,10H2,1H3,(H,22,23,25)/b24-9+ |
| InChIKey | WLUSHAWWZDFKFC-PGGKNCGUSA-N |
| XLogP | 4.90 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|