C19H16N6O4S — CID 91069918
5-[[[6-(2-ethoxyphenyl)-7-hydroxythieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]-1H-pyrimidine-2,4-dione (PubChem CID 91069918) has the molecular formula C19H16N6O4S and a molecular weight of 424.44 g/mol. Its IUPAC name is 5-[[[6-(2-ethoxyphenyl)-7-hydroxythieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[[[6-(2-ethoxyphenyl)-7-hydroxythieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91069918 |
| Molecular Formula | C19H16N6O4S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 5-[[[6-(2-ethoxyphenyl)-7-hydroxythieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]-1H-pyrimidine-2,4-dione |
| SMILES | CCOc1ccccc1-c1sc2c(/N=N/Cc3c[nH]c(=O)[nH]c3=O)ncnc2c1O |
| InChI | InChI=1S/C19H16N6O4S/c1-2-29-12-6-4-3-5-11(12)15-14(26)13-16(30-15)17(22-9-21-13)25-23-8-10-7-20-19(28)24-18(10)27/h3-7,9,26H,2,8H2,1H3,(H2,20,24,27,28)/b25-23+ |
| InChIKey | XYZCMAYCFHWBKB-WJTDDFOZSA-N |
| XLogP | 3.12 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|