C23H21FN4O3S — CID 91300419
5-[[[6-(2-ethoxy-4-fluorophenyl)-7-methylthieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]-2-methoxyphenol (PubChem CID 91300419) has the molecular formula C23H21FN4O3S and a molecular weight of 452.51 g/mol. Its IUPAC name is 5-[[[6-(2-ethoxy-4-fluorophenyl)-7-methylthieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]-2-methoxyphenol.
| Compound Name | 5-[[[6-(2-ethoxy-4-fluorophenyl)-7-methylthieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 91300419 |
| Molecular Formula | C23H21FN4O3S |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 5-[[[6-(2-ethoxy-4-fluorophenyl)-7-methylthieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]-2-methoxyphenol |
| SMILES | CCOc1cc(F)ccc1-c1sc2c(/N=N/Cc3ccc(OC)c(O)c3)ncnc2c1C |
| InChI | InChI=1S/C23H21FN4O3S/c1-4-31-19-10-15(24)6-7-16(19)21-13(2)20-22(32-21)23(26-12-25-20)28-27-11-14-5-8-18(30-3)17(29)9-14/h5-10,12,29H,4,11H2,1-3H3/b28-27+ |
| InChIKey | ZHNSZIGHHYBCRS-BYYHNAKLSA-N |
| XLogP | 6.20 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|