C14H11IN4O2S — CID 90710184
5-[[(6-iodothieno[3,2-d]pyrimidin-4-yl)diazenyl]methyl]-2-methoxyphenol (PubChem CID 90710184) has the molecular formula C14H11IN4O2S and a molecular weight of 426.24 g/mol. Its IUPAC name is 5-[[(6-iodothieno[3,2-d]pyrimidin-4-yl)diazenyl]methyl]-2-methoxyphenol.
| Compound Name | 5-[[(6-iodothieno[3,2-d]pyrimidin-4-yl)diazenyl]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 90710184 |
| Molecular Formula | C14H11IN4O2S |
| Molecular Weight | 426.24 g/mol |
| Exact Mass | 425.96 |
| IUPAC Name | 5-[[(6-iodothieno[3,2-d]pyrimidin-4-yl)diazenyl]methyl]-2-methoxyphenol |
| SMILES | COc1ccc(C/N=N/c2ncnc3cc(I)sc23)cc1O |
| InChI | InChI=1S/C14H11IN4O2S/c1-21-11-3-2-8(4-10(11)20)6-18-19-14-13-9(16-7-17-14)5-12(15)22-13/h2-5,7,20H,6H2,1H3/b19-18+ |
| InChIKey | LNVHFNMJTYXHMV-VHEBQXMUSA-N |
| XLogP | 4.29 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.24 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|