C19H21NO5S — CID 162679628
2-methoxy-5-[2-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)ethyl]phenol (PubChem CID 162679628) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-methoxy-5-[2-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)ethyl]phenol.
| Compound Name | 2-methoxy-5-[2-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)ethyl]phenol |
|---|---|
| PubChem CID | 162679628 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-methoxy-5-[2-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)ethyl]phenol |
| SMILES | COc1ccc(CCc2nc3cc(OC)c(OC)c(OC)c3s2)cc1O |
| InChI | InChI=1S/C19H21NO5S/c1-22-14-7-5-11(9-13(14)21)6-8-16-20-12-10-15(23-2)17(24-3)18(25-4)19(12)26-16/h5,7,9-10,21H,6,8H2,1-4H3 |
| InChIKey | AGSIMEHHCHGERU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |