C23H22N4O4S — CID 90940228
5-[[[6-(2-ethoxyphenyl)-7-methoxythieno[3,2-d]pyrimidin-2-yl]diazenyl]methyl]-2-methoxyphenol (PubChem CID 90940228) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is 5-[[[6-(2-ethoxyphenyl)-7-methoxythieno[3,2-d]pyrimidin-2-yl]diazenyl]methyl]-2-methoxyphenol.
| Compound Name | 5-[[[6-(2-ethoxyphenyl)-7-methoxythieno[3,2-d]pyrimidin-2-yl]diazenyl]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 90940228 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 5-[[[6-(2-ethoxyphenyl)-7-methoxythieno[3,2-d]pyrimidin-2-yl]diazenyl]methyl]-2-methoxyphenol |
| SMILES | CCOc1ccccc1-c1sc2cnc(/N=N/Cc3ccc(OC)c(O)c3)nc2c1OC |
| InChI | InChI=1S/C23H22N4O4S/c1-4-31-17-8-6-5-7-15(17)22-21(30-3)20-19(32-22)13-24-23(26-20)27-25-12-14-9-10-18(29-2)16(28)11-14/h5-11,13,28H,4,12H2,1-3H3/b27-25+ |
| InChIKey | AQSSTBLXPOOMGL-IMVLJIQESA-N |
| XLogP | 5.76 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|