C20H20N2O3 — CID 130232591
2-ethoxy-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]methyl]phenol (PubChem CID 130232591) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-ethoxy-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]methyl]phenol.
| Compound Name | 2-ethoxy-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]methyl]phenol |
|---|---|
| PubChem CID | 130232591 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-ethoxy-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]methyl]phenol |
| SMILES | CCOc1ccc(Cc2cc(-c3ccccc3OC)ncn2)cc1O |
| InChI | InChI=1S/C20H20N2O3/c1-3-25-20-9-8-14(11-18(20)23)10-15-12-17(22-13-21-15)16-6-4-5-7-19(16)24-2/h4-9,11-13,23H,3,10H2,1-2H3 |
| InChIKey | JHRNILJGHYXEQG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |