C19H15ClN2O3 — CID 161421648
2-chloro-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]methyl]benzoic acid (PubChem CID 161421648) has the molecular formula C19H15ClN2O3 and a molecular weight of 354.79 g/mol. Its IUPAC name is 2-chloro-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]methyl]benzoic acid.
| Compound Name | 2-chloro-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 161421648 |
| Molecular Formula | C19H15ClN2O3 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-chloro-5-[[6-(2-methoxyphenyl)pyrimidin-4-yl]methyl]benzoic acid |
| SMILES | COc1ccccc1-c1cc(Cc2ccc(Cl)c(C(=O)O)c2)ncn1 |
| InChI | InChI=1S/C19H15ClN2O3/c1-25-18-5-3-2-4-14(18)17-10-13(21-11-22-17)8-12-6-7-16(20)15(9-12)19(23)24/h2-7,9-11H,8H2,1H3,(H,23,24) |
| InChIKey | FTXLYUUUXWRIFN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |