C18H13F2N3O3 — CID 158346629
4-(4-fluoro-2-methoxyphenyl)-6-[(4-fluoro-3-nitrophenyl)methyl]pyrimidine (PubChem CID 158346629) has the molecular formula C18H13F2N3O3 and a molecular weight of 357.32 g/mol. Its IUPAC name is 4-(4-fluoro-2-methoxyphenyl)-6-[(4-fluoro-3-nitrophenyl)methyl]pyrimidine.
| Compound Name | 4-(4-fluoro-2-methoxyphenyl)-6-[(4-fluoro-3-nitrophenyl)methyl]pyrimidine |
|---|---|
| PubChem CID | 158346629 |
| Molecular Formula | C18H13F2N3O3 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 4-(4-fluoro-2-methoxyphenyl)-6-[(4-fluoro-3-nitrophenyl)methyl]pyrimidine |
| SMILES | COc1cc(F)ccc1-c1cc(Cc2ccc(F)c([N+](=O)[O-])c2)ncn1 |
| InChI | InChI=1S/C18H13F2N3O3/c1-26-18-8-12(19)3-4-14(18)16-9-13(21-10-22-16)6-11-2-5-15(20)17(7-11)23(24)25/h2-5,7-10H,6H2,1H3 |
| InChIKey | TYRRAWXHKMXNDT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|