C24H22N4O3S — CID 11698029
methyl (1Z)-N-[6-(2-ethoxyphenyl)-7-methylthieno[3,2-d]pyrimidin-4-yl]-4-formylbenzenecarbohydrazonate (PubChem CID 11698029) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is methyl (1Z)-N-[6-(2-ethoxyphenyl)-7-methylthieno[3,2-d]pyrimidin-4-yl]-4-formylbenzenecarbohydrazonate.
| Compound Name | methyl (1Z)-N-[6-(2-ethoxyphenyl)-7-methylthieno[3,2-d]pyrimidin-4-yl]-4-formylbenzenecarbohydrazonate |
|---|---|
| PubChem CID | 11698029 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | methyl (1Z)-N-[6-(2-ethoxyphenyl)-7-methylthieno[3,2-d]pyrimidin-4-yl]-4-formylbenzenecarbohydrazonate |
| SMILES | CCOc1ccccc1-c1sc2c(N/N=C(\OC)c3ccc(C=O)cc3)ncnc2c1C |
| InChI | InChI=1S/C24H22N4O3S/c1-4-31-19-8-6-5-7-18(19)21-15(2)20-22(32-21)23(26-14-25-20)27-28-24(30-3)17-11-9-16(13-29)10-12-17/h5-14H,4H2,1-3H3,(H,25,26,27)/b28-24- |
| InChIKey | SCQWTAZZWDAVIE-COOPMVRXSA-N |
| XLogP | 5.30 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|