C26H21N5OS — CID 152768332
7-methyl-6-(2-phenylmethoxyphenyl)-N-(pyridin-3-ylmethylideneamino)thieno[3,2-d]pyrimidin-4-amine (PubChem CID 152768332) has the molecular formula C26H21N5OS and a molecular weight of 451.56 g/mol. Its IUPAC name is 7-methyl-6-(2-phenylmethoxyphenyl)-N-(pyridin-3-ylmethylideneamino)thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 7-methyl-6-(2-phenylmethoxyphenyl)-N-(pyridin-3-ylmethylideneamino)thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 152768332 |
| Molecular Formula | C26H21N5OS |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 7-methyl-6-(2-phenylmethoxyphenyl)-N-(pyridin-3-ylmethylideneamino)thieno[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1c(-c2ccccc2OCc2ccccc2)sc2c(NN=Cc3cccnc3)ncnc12 |
| InChI | InChI=1S/C26H21N5OS/c1-18-23-25(26(29-17-28-23)31-30-15-20-10-7-13-27-14-20)33-24(18)21-11-5-6-12-22(21)32-16-19-8-3-2-4-9-19/h2-15,17H,16H2,1H3,(H,28,29,31) |
| InChIKey | GBUVBJXIOYXALT-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|