C17H13N5S2 — CID 90734863
7-methyl-N-(pyridin-2-ylmethylideneamino)-6-thiophen-3-ylthieno[3,2-d]pyrimidin-4-amine (PubChem CID 90734863) has the molecular formula C17H13N5S2 and a molecular weight of 351.46 g/mol. Its IUPAC name is 7-methyl-N-(pyridin-2-ylmethylideneamino)-6-thiophen-3-ylthieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 7-methyl-N-(pyridin-2-ylmethylideneamino)-6-thiophen-3-ylthieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 90734863 |
| Molecular Formula | C17H13N5S2 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 7-methyl-N-(pyridin-2-ylmethylideneamino)-6-thiophen-3-ylthieno[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1c(-c2ccsc2)sc2c(NN=Cc3ccccn3)ncnc12 |
| InChI | InChI=1S/C17H13N5S2/c1-11-14-16(24-15(11)12-5-7-23-9-12)17(20-10-19-14)22-21-8-13-4-2-3-6-18-13/h2-10H,1H3,(H,19,20,22) |
| InChIKey | MXYIJGCKZAMTMT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|