C22H18N4O3S — CID 90906572
4-[[[6-(3-methoxyphenyl)-7-methylthieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]benzoic acid (PubChem CID 90906572) has the molecular formula C22H18N4O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is 4-[[[6-(3-methoxyphenyl)-7-methylthieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]benzoic acid.
| Compound Name | 4-[[[6-(3-methoxyphenyl)-7-methylthieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 90906572 |
| Molecular Formula | C22H18N4O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 4-[[[6-(3-methoxyphenyl)-7-methylthieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]benzoic acid |
| SMILES | COc1cccc(-c2sc3c(/N=N/Cc4ccc(C(=O)O)cc4)ncnc3c2C)c1 |
| InChI | InChI=1S/C22H18N4O3S/c1-13-18-20(30-19(13)16-4-3-5-17(10-16)29-2)21(24-12-23-18)26-25-11-14-6-8-15(9-7-14)22(27)28/h3-10,12H,11H2,1-2H3,(H,27,28)/b26-25+ |
| InChIKey | ANTOCOJNCZEPTA-OCEACIFDSA-N |
| XLogP | 5.66 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|