C14H13N3OS — CID 102685622
7-methyl-3-(2-pyridin-3-ylethyl)thieno[3,2-d]pyrimidin-4-one (PubChem CID 102685622) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is 7-methyl-3-(2-pyridin-3-ylethyl)thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 7-methyl-3-(2-pyridin-3-ylethyl)thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 102685622 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 7-methyl-3-(2-pyridin-3-ylethyl)thieno[3,2-d]pyrimidin-4-one |
| SMILES | Cc1csc2c(=O)n(CCc3cccnc3)cnc12 |
| InChI | InChI=1S/C14H13N3OS/c1-10-8-19-13-12(10)16-9-17(14(13)18)6-4-11-3-2-5-15-7-11/h2-3,5,7-9H,4,6H2,1H3 |
| InChIKey | OGOBXTZPMRRLQN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |