C15H14FN3OS — CID 102685564
3-[2-(4-fluoroanilino)ethyl]-7-methylthieno[3,2-d]pyrimidin-4-one (PubChem CID 102685564) has the molecular formula C15H14FN3OS and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-[2-(4-fluoroanilino)ethyl]-7-methylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[2-(4-fluoroanilino)ethyl]-7-methylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 102685564 |
| Molecular Formula | C15H14FN3OS |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-[2-(4-fluoroanilino)ethyl]-7-methylthieno[3,2-d]pyrimidin-4-one |
| SMILES | Cc1csc2c(=O)n(CCNc3ccc(F)cc3)cnc12 |
| InChI | InChI=1S/C15H14FN3OS/c1-10-8-21-14-13(10)18-9-19(15(14)20)7-6-17-12-4-2-11(16)3-5-12/h2-5,8-9,17H,6-7H2,1H3 |
| InChIKey | XBFRRTQRZDSQDQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |