C11H13ClN2OS — CID 102685321
3-(4-chlorobutyl)-7-methylthieno[3,2-d]pyrimidin-4-one (PubChem CID 102685321) has the molecular formula C11H13ClN2OS and a molecular weight of 256.76 g/mol. Its IUPAC name is 3-(4-chlorobutyl)-7-methylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-(4-chlorobutyl)-7-methylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 102685321 |
| Molecular Formula | C11H13ClN2OS |
| Molecular Weight | 256.76 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 3-(4-chlorobutyl)-7-methylthieno[3,2-d]pyrimidin-4-one |
| SMILES | Cc1csc2c(=O)n(CCCCCl)cnc12 |
| InChI | InChI=1S/C11H13ClN2OS/c1-8-6-16-10-9(8)13-7-14(11(10)15)5-3-2-4-12/h6-7H,2-5H2,1H3 |
| InChIKey | PHGSVJTWHLYNNI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.76 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|