About S-(2-tributoxysilylethyl) heptanethioate
S-(2-tributoxysilylethyl) heptanethioate (PubChem CID 91381484) has the molecular formula C21H44O4SSi
and a molecular weight of 420.73 g/mol. Its IUPAC name is S-(2-tributoxysilylethyl) heptanethioate.
Molecular Properties
| Compound Name | S-(2-tributoxysilylethyl) heptanethioate |
| PubChem CID | 91381484 |
| Molecular Formula | C21H44O4SSi |
| Molecular Weight | 420.73 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | S-(2-tributoxysilylethyl) heptanethioate |
| SMILES | CCCCCCC(=O)SCC[Si](OCCCC)(OCCCC)OCCCC |
| InChI | InChI=1S/C21H44O4SSi/c1-5-9-13-14-15-21(22)26-19-20-27(23-16-10-6-2,24-17-11-7-3)25-18-12-8-4/h5-20H2,1-4H3 |
| InChIKey | GTOWMHYRUWLLGE-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.73 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-tributoxysilylethyl) heptanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-tributoxysilylethyl) heptanethioate?
The IUPAC name of S-(2-tributoxysilylethyl) heptanethioate (CID 91381484) is S-(2-tributoxysilylethyl) heptanethioate.
What is the SMILES notation for S-(2-tributoxysilylethyl) heptanethioate?
The canonical SMILES for S-(2-tributoxysilylethyl) heptanethioate is CCCCCCC(=O)SCC[Si](OCCCC)(OCCCC)OCCCC.
What is the InChIKey of S-(2-tributoxysilylethyl) heptanethioate?
The InChIKey is GTOWMHYRUWLLGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44O4SSi/c1-5-9-13-14-15-21(22)26-19-20-27(23-16-10-6-2,24-17-11-7-3)25-18-12-8-4/h5-20H2,1-4H3.
What are the key properties of S-(2-tributoxysilylethyl) heptanethioate?
S-(2-tributoxysilylethyl) heptanethioate has a molecular weight of 420.73 g/mol, XLogP of 6.61, 20 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-tributoxysilylethyl) heptanethioate is sourced from PubChem (CID 91381484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).