C12H19N — CID 91381985
N-(8-methyldeca-1,8,9-trien-2-yl)methanimine (PubChem CID 91381985) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is N-(8-methyldeca-1,8,9-trien-2-yl)methanimine.
| Compound Name | N-(8-methyldeca-1,8,9-trien-2-yl)methanimine |
|---|---|
| PubChem CID | 91381985 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N-(8-methyldeca-1,8,9-trien-2-yl)methanimine |
| SMILES | C=C=C(C)CCCCCC(=C)N=C |
| InChI | InChI=1S/C12H19N/c1-5-11(2)9-7-6-8-10-12(3)13-4/h1,3-4,6-10H2,2H3 |
| InChIKey | VYMFETUJRIDQMV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|