C23H28ClNO2 — CID 91382156
N-[[2-chloro-5-(2-methoxyethyl)phenyl]methyl]-N-cyclopropyl-2-methyl-3-phenylpropanamide (PubChem CID 91382156) has the molecular formula C23H28ClNO2 and a molecular weight of 385.94 g/mol. Its IUPAC name is N-[[2-chloro-5-(2-methoxyethyl)phenyl]methyl]-N-cyclopropyl-2-methyl-3-phenylpropanamide.
| Compound Name | N-[[2-chloro-5-(2-methoxyethyl)phenyl]methyl]-N-cyclopropyl-2-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 91382156 |
| Molecular Formula | C23H28ClNO2 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-[[2-chloro-5-(2-methoxyethyl)phenyl]methyl]-N-cyclopropyl-2-methyl-3-phenylpropanamide |
| SMILES | COCCc1ccc(Cl)c(CN(C(=O)C(C)Cc2ccccc2)C2CC2)c1 |
| InChI | InChI=1S/C23H28ClNO2/c1-17(14-18-6-4-3-5-7-18)23(26)25(21-9-10-21)16-20-15-19(12-13-27-2)8-11-22(20)24/h3-8,11,15,17,21H,9-10,12-14,16H2,1-2H3 |
| InChIKey | SKDLZLYVLYRJDF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |