C14H13N5O — CID 91383931
N-[(pyridin-3-ylamino)methyl]-1H-pyrrolo[2,3-c]pyridine-5-carboxamide (PubChem CID 91383931) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is N-[(pyridin-3-ylamino)methyl]-1H-pyrrolo[2,3-c]pyridine-5-carboxamide.
| Compound Name | N-[(pyridin-3-ylamino)methyl]-1H-pyrrolo[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 91383931 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-[(pyridin-3-ylamino)methyl]-1H-pyrrolo[2,3-c]pyridine-5-carboxamide |
| SMILES | O=C(NCNc1cccnc1)c1cc2cc[nH]c2cn1 |
| InChI | InChI=1S/C14H13N5O/c20-14(19-9-18-11-2-1-4-15-7-11)12-6-10-3-5-16-13(10)8-17-12/h1-8,16,18H,9H2,(H,19,20) |
| InChIKey | ITERJKMBVXXLFX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|