C19H20N2O2 — CID 144689405
ethane;1-(1H-indol-5-yl)-4-pyridin-3-ylbutane-1,4-dione (PubChem CID 144689405) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is ethane;1-(1H-indol-5-yl)-4-pyridin-3-ylbutane-1,4-dione.
| Compound Name | ethane;1-(1H-indol-5-yl)-4-pyridin-3-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 144689405 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | ethane;1-(1H-indol-5-yl)-4-pyridin-3-ylbutane-1,4-dione |
| SMILES | CC.O=C(CCC(=O)c1ccc2[nH]ccc2c1)c1cccnc1 |
| InChI | InChI=1S/C17H14N2O2.C2H6/c20-16(5-6-17(21)14-2-1-8-18-11-14)13-3-4-15-12(10-13)7-9-19-15;1-2/h1-4,7-11,19H,5-6H2;1-2H3 |
| InChIKey | IMHMDXUPFJGCMI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |