C20H22N2O3 — CID 144689335
ethane;1-(1H-indol-5-yl)-4-(3-methoxy-2-pyridinyl)butane-1,4-dione (PubChem CID 144689335) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is ethane;1-(1H-indol-5-yl)-4-(3-methoxy-2-pyridinyl)butane-1,4-dione.
| Compound Name | ethane;1-(1H-indol-5-yl)-4-(3-methoxy-2-pyridinyl)butane-1,4-dione |
|---|---|
| PubChem CID | 144689335 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | ethane;1-(1H-indol-5-yl)-4-(3-methoxy-2-pyridinyl)butane-1,4-dione |
| SMILES | CC.COc1cccnc1C(=O)CCC(=O)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C18H16N2O3.C2H6/c1-23-17-3-2-9-20-18(17)16(22)7-6-15(21)13-4-5-14-12(11-13)8-10-19-14;1-2/h2-5,8-11,19H,6-7H2,1H3;1-2H3 |
| InChIKey | RMUKWLLLZCCIHS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |