About 5-(4-aminophenyl)-2,4-dimethylpentan-2-ol;ethane
5-(4-aminophenyl)-2,4-dimethylpentan-2-ol;ethane (PubChem CID 91386742) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is 5-(4-aminophenyl)-2,4-dimethylpentan-2-ol;ethane.
Molecular Properties
| Compound Name | 5-(4-aminophenyl)-2,4-dimethylpentan-2-ol;ethane |
| PubChem CID | 91386742 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 5-(4-aminophenyl)-2,4-dimethylpentan-2-ol;ethane |
| SMILES | CC.CC(Cc1ccc(N)cc1)CC(C)(C)O |
| InChI | InChI=1S/C13H21NO.C2H6/c1-10(9-13(2,3)15)8-11-4-6-12(14)7-5-11;1-2/h4-7,10,15H,8-9,14H2,1-3H3;1-2H3 |
| InChIKey | AWONIRRLYQSFQD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-aminophenyl)-2,4-dimethylpentan-2-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-aminophenyl)-2,4-dimethylpentan-2-ol;ethane?
The IUPAC name of 5-(4-aminophenyl)-2,4-dimethylpentan-2-ol;ethane (CID 91386742) is 5-(4-aminophenyl)-2,4-dimethylpentan-2-ol;ethane.
What is the SMILES notation for 5-(4-aminophenyl)-2,4-dimethylpentan-2-ol;ethane?
The canonical SMILES for 5-(4-aminophenyl)-2,4-dimethylpentan-2-ol;ethane is CC.CC(Cc1ccc(N)cc1)CC(C)(C)O.
What is the InChIKey of 5-(4-aminophenyl)-2,4-dimethylpentan-2-ol;ethane?
The InChIKey is AWONIRRLYQSFQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO.C2H6/c1-10(9-13(2,3)15)8-11-4-6-12(14)7-5-11;1-2/h4-7,10,15H,8-9,14H2,1-3H3;1-2H3.
What are the key properties of 5-(4-aminophenyl)-2,4-dimethylpentan-2-ol;ethane?
5-(4-aminophenyl)-2,4-dimethylpentan-2-ol;ethane has a molecular weight of 237.39 g/mol, XLogP of 3.63, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-aminophenyl)-2,4-dimethylpentan-2-ol;ethane is sourced from PubChem (CID 91386742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).