C11H12N2S — CID 91387936
4-ethyl-5-methyl-2-pyridin-2-yl-1,3-thiazole (PubChem CID 91387936) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is 4-ethyl-5-methyl-2-pyridin-2-yl-1,3-thiazole.
| Compound Name | 4-ethyl-5-methyl-2-pyridin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 91387936 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 4-ethyl-5-methyl-2-pyridin-2-yl-1,3-thiazole |
| SMILES | CCc1nc(-c2ccccn2)sc1C |
| InChI | InChI=1S/C11H12N2S/c1-3-9-8(2)14-11(13-9)10-6-4-5-7-12-10/h4-7H,3H2,1-2H3 |
| InChIKey | DNVAILYTTRUNCE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |