C13H19N7O4 — CID 91388946
[2-oxo-2-[2-(6-oxo-3-pentyl-7H-purin-2-yl)hydrazinyl]ethyl]carbamic acid (PubChem CID 91388946) has the molecular formula C13H19N7O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is [2-oxo-2-[2-(6-oxo-3-pentyl-7H-purin-2-yl)hydrazinyl]ethyl]carbamic acid.
| Compound Name | [2-oxo-2-[2-(6-oxo-3-pentyl-7H-purin-2-yl)hydrazinyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 91388946 |
| Molecular Formula | C13H19N7O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [2-oxo-2-[2-(6-oxo-3-pentyl-7H-purin-2-yl)hydrazinyl]ethyl]carbamic acid |
| SMILES | CCCCCn1c(NNC(=O)CNC(=O)O)nc(=O)c2[nH]cnc21 |
| InChI | InChI=1S/C13H19N7O4/c1-2-3-4-5-20-10-9(15-7-16-10)11(22)17-12(20)19-18-8(21)6-14-13(23)24/h7,14H,2-6H2,1H3,(H,15,16)(H,18,21)(H,23,24)(H,17,19,22) |
| InChIKey | FKZOYZUHMADFIE-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 154.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|