C9H17N7O — CID 135509549
4-[(E)-[butyl(methyl)amino]diazenyl]-1H-imidazole-5-carbohydrazide (PubChem CID 135509549) has the molecular formula C9H17N7O and a molecular weight of 239.28 g/mol. Its IUPAC name is 4-[(E)-[butyl(methyl)amino]diazenyl]-1H-imidazole-5-carbohydrazide.
| Compound Name | 4-[(E)-[butyl(methyl)amino]diazenyl]-1H-imidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 135509549 |
| Molecular Formula | C9H17N7O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-[(E)-[butyl(methyl)amino]diazenyl]-1H-imidazole-5-carbohydrazide |
| SMILES | CCCCN(C)/N=N/c1nc[nH]c1C(=O)NN |
| InChI | InChI=1S/C9H17N7O/c1-3-4-5-16(2)15-14-8-7(9(17)13-10)11-6-12-8/h6H,3-5,10H2,1-2H3,(H,11,12)(H,13,17)/b15-14+ |
| InChIKey | OLDPKRMBMAUGRR-CCEZHUSRSA-N |
| XLogP | 0.74 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|