C9H13F2N5O2 — CID 135684125
methyl 4-[(E)-[bis(2-fluoroethyl)amino]diazenyl]-1H-imidazole-5-carboxylate (PubChem CID 135684125) has the molecular formula C9H13F2N5O2 and a molecular weight of 261.23 g/mol. Its IUPAC name is methyl 4-[(E)-[bis(2-fluoroethyl)amino]diazenyl]-1H-imidazole-5-carboxylate.
| Compound Name | methyl 4-[(E)-[bis(2-fluoroethyl)amino]diazenyl]-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 135684125 |
| Molecular Formula | C9H13F2N5O2 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | methyl 4-[(E)-[bis(2-fluoroethyl)amino]diazenyl]-1H-imidazole-5-carboxylate |
| SMILES | COC(=O)c1[nH]cnc1/N=N/N(CCF)CCF |
| InChI | InChI=1S/C9H13F2N5O2/c1-18-9(17)7-8(13-6-12-7)14-15-16(4-2-10)5-3-11/h6H,2-5H2,1H3,(H,12,13)/b15-14+ |
| InChIKey | OBUCVYXNRXHFLF-CCEZHUSRSA-N |
| XLogP | 1.44 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|