C12H18N6O5 — CID 135459384
2-[2-acetyloxyethyl-[(E)-(5-carbamoyl-1H-imidazol-4-yl)diazenyl]amino]ethyl acetate (PubChem CID 135459384) has the molecular formula C12H18N6O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-[2-acetyloxyethyl-[(E)-(5-carbamoyl-1H-imidazol-4-yl)diazenyl]amino]ethyl acetate.
| Compound Name | 2-[2-acetyloxyethyl-[(E)-(5-carbamoyl-1H-imidazol-4-yl)diazenyl]amino]ethyl acetate |
|---|---|
| PubChem CID | 135459384 |
| Molecular Formula | C12H18N6O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[2-acetyloxyethyl-[(E)-(5-carbamoyl-1H-imidazol-4-yl)diazenyl]amino]ethyl acetate |
| SMILES | CC(=O)OCCN(CCOC(C)=O)/N=N/c1nc[nH]c1C(N)=O |
| InChI | InChI=1S/C12H18N6O5/c1-8(19)22-5-3-18(4-6-23-9(2)20)17-16-12-10(11(13)21)14-7-15-12/h7H,3-6H2,1-2H3,(H2,13,21)(H,14,15)/b17-16+ |
| InChIKey | CTQFJPCITVNZNM-WUKNDPDISA-N |
| XLogP | -0.06 |
| TPSA | 152.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|