C13H17N7O — CID 135468258
4-[(E)-[benzyl(dimethylamino)amino]diazenyl]-1H-imidazole-5-carboxamide (PubChem CID 135468258) has the molecular formula C13H17N7O and a molecular weight of 287.33 g/mol. Its IUPAC name is 4-[(E)-[benzyl(dimethylamino)amino]diazenyl]-1H-imidazole-5-carboxamide.
| Compound Name | 4-[(E)-[benzyl(dimethylamino)amino]diazenyl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 135468258 |
| Molecular Formula | C13H17N7O |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-[(E)-[benzyl(dimethylamino)amino]diazenyl]-1H-imidazole-5-carboxamide |
| SMILES | CN(C)N(Cc1ccccc1)/N=N/c1nc[nH]c1C(N)=O |
| InChI | InChI=1S/C13H17N7O/c1-19(2)20(8-10-6-4-3-5-7-10)18-17-13-11(12(14)21)15-9-16-13/h3-7,9H,8H2,1-2H3,(H2,14,21)(H,15,16)/b18-17+ |
| InChIKey | DAMKQSOZEOCASA-ISLYRVAYSA-N |
| XLogP | 1.49 |
| TPSA | 102.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|