C8H11FN6O2 — CID 166540383
4-[(E)-[acetyl(2-fluoroethyl)amino]diazenyl]-1H-imidazole-5-carboxamide (PubChem CID 166540383) has the molecular formula C8H11FN6O2 and a molecular weight of 242.21 g/mol. Its IUPAC name is 4-[(E)-[acetyl(2-fluoroethyl)amino]diazenyl]-1H-imidazole-5-carboxamide.
| Compound Name | 4-[(E)-[acetyl(2-fluoroethyl)amino]diazenyl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 166540383 |
| Molecular Formula | C8H11FN6O2 |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4-[(E)-[acetyl(2-fluoroethyl)amino]diazenyl]-1H-imidazole-5-carboxamide |
| SMILES | CC(=O)N(CCF)/N=N/c1nc[nH]c1C(N)=O |
| InChI | InChI=1S/C8H11FN6O2/c1-5(16)15(3-2-9)14-13-8-6(7(10)17)11-4-12-8/h4H,2-3H2,1H3,(H2,10,17)(H,11,12)/b14-13+ |
| InChIKey | MEEDFJQCNQIJKP-BUHFOSPRSA-N |
| XLogP | 0.33 |
| TPSA | 116.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|