C7H13N7 — CID 135778850
4-[(E)-dimethylaminodiazenyl]-N'-methyl-1H-imidazole-5-carboximidamide (PubChem CID 135778850) has the molecular formula C7H13N7 and a molecular weight of 195.23 g/mol. Its IUPAC name is 4-[(E)-dimethylaminodiazenyl]-N'-methyl-1H-imidazole-5-carboximidamide.
| Compound Name | 4-[(E)-dimethylaminodiazenyl]-N'-methyl-1H-imidazole-5-carboximidamide |
|---|---|
| PubChem CID | 135778850 |
| Molecular Formula | C7H13N7 |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | 4-[(E)-dimethylaminodiazenyl]-N'-methyl-1H-imidazole-5-carboximidamide |
| SMILES | C/N=C(\N)c1[nH]cnc1/N=N/N(C)C |
| InChI | InChI=1S/C7H13N7/c1-9-6(8)5-7(11-4-10-5)12-13-14(2)3/h4H,1-3H3,(H2,8,9)(H,10,11)/b13-12+ |
| InChIKey | VBFXWBABXCIKRL-OUKQBFOZSA-N |
| XLogP | 0.31 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|