C14H24N7O2 — CID 135524549
CID 135524549 (PubChem CID 135524549) has the molecular formula C14H24N7O2 and a molecular weight of 322.39 g/mol.
| Compound Name | CID 135524549 |
|---|---|
| PubChem CID | 135524549 |
| Molecular Formula | C14H24N7O2 |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | — |
| SMILES | CN(/N=N/c1nc[nH]c1C(N)=O)C1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C14H24N7O2/c1-13(2)6-9(7-14(3,4)21(13)23)20(5)19-18-12-10(11(15)22)16-8-17-12/h8-9H,6-7H2,1-5H3,(H2,15,22)(H,16,17)/b19-18+ |
| InChIKey | CBANYOPUPVYRMC-VHEBQXMUSA-N |
| XLogP | 1.81 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|