C35H53F3O7 — CID 91389927
[(2,4-diethylcyclopentyl)-(2-oxooxolan-3-yl)methyl] 2,2,2-trifluoroacetate;3-[(3,5-diethyl-8-tricyclo[5.2.1.02,6]decanyl)-hydroxymethyl]oxolan-2-one (PubChem CID 91389927) has the molecular formula C35H53F3O7 and a molecular weight of 642.80 g/mol. Its IUPAC name is [(2,4-diethylcyclopentyl)-(2-oxooxolan-3-yl)methyl] 2,2,2-trifluoroacetate;3-[(3,5-diethyl-8-tricyclo[5.2.1.02,6]decanyl)-hydroxymethyl]oxolan-2-one.
| Compound Name | [(2,4-diethylcyclopentyl)-(2-oxooxolan-3-yl)methyl] 2,2,2-trifluoroacetate;3-[(3,5-diethyl-8-tricyclo[5.2.1.02,6]decanyl)-hydroxymethyl]oxolan-2-one |
|---|---|
| PubChem CID | 91389927 |
| Molecular Formula | C35H53F3O7 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.37 |
| IUPAC Name | [(2,4-diethylcyclopentyl)-(2-oxooxolan-3-yl)methyl] 2,2,2-trifluoroacetate;3-[(3,5-diethyl-8-tricyclo[5.2.1.02,6]decanyl)-hydroxymethyl]oxolan-2-one |
| SMILES | CCC1CC(CC)C(C(OC(=O)C(F)(F)F)C2CCOC2=O)C1.CCC1CC(CC)C2C3CC(CC3C(O)C3CCOC3=O)C12 |
| InChI | InChI=1S/C19H30O3.C16H23F3O4/c1-3-10-7-11(4-2)17-14-8-12(16(10)17)9-15(14)18(20)13-5-6-22-19(13)21;1-3-9-7-10(4-2)12(8-9)13(11-5-6-22-14(11)20)23-15(21)16(17,18)19/h10-18,20H,3-9H2,1-2H3;9-13H,3-8H2,1-2H3 |
| InChIKey | WCMDPJKYUJQWCG-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|