C26H23ClN4O4 — CID 91390305
4-chloro-5-(4,6-dicyano-3-pyridinyl)-2-(3-hydroxypropoxy)-N-[(2-methoxy-6-methylphenyl)methyl]benzamide (PubChem CID 91390305) has the molecular formula C26H23ClN4O4 and a molecular weight of 490.95 g/mol. Its IUPAC name is 4-chloro-5-(4,6-dicyano-3-pyridinyl)-2-(3-hydroxypropoxy)-N-[(2-methoxy-6-methylphenyl)methyl]benzamide.
| Compound Name | 4-chloro-5-(4,6-dicyano-3-pyridinyl)-2-(3-hydroxypropoxy)-N-[(2-methoxy-6-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 91390305 |
| Molecular Formula | C26H23ClN4O4 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 4-chloro-5-(4,6-dicyano-3-pyridinyl)-2-(3-hydroxypropoxy)-N-[(2-methoxy-6-methylphenyl)methyl]benzamide |
| SMILES | COc1cccc(C)c1CNC(=O)c1cc(-c2cnc(C#N)cc2C#N)c(Cl)cc1OCCCO |
| InChI | InChI=1S/C26H23ClN4O4/c1-16-5-3-6-24(34-2)21(16)14-31-26(33)20-10-19(23(27)11-25(20)35-8-4-7-32)22-15-30-18(13-29)9-17(22)12-28/h3,5-6,9-11,15,32H,4,7-8,14H2,1-2H3,(H,31,33) |
| InChIKey | VWQKPLZLOCQOSP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|